CAS 2241588-79-2 is the registry number for 2-Bromo-5-thiocyanato-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-bromo-5-thiocyanatobenzoate (CAS 2241588-79-2) is a chemical compound with the molecular formula C9H6BrNO2S and a molecular weight of 272.12 g/mol. IUPAC name: methyl 2-bromo-5-thiocyanatobenzoate. InChIKey: KWNHXDQDGOIZDW-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2S |
|---|---|
| Molecular weight | 272.12 g/mol |
| IUPAC name | methyl 2-bromo-5-thiocyanatobenzoate |
| InChIKey | KWNHXDQDGOIZDW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)SC#N)Br |
Computed by PubChem (NCBI)