Products 2241588-79-2

CAS 2241588-79-2 is the registry number for 2-Bromo-5-thiocyanato-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-bromo-5-thiocyanatobenzoate (CAS 2241588-79-2) is a chemical compound with the molecular formula C9H6BrNO2S and a molecular weight of 272.12 g/mol. IUPAC name: methyl 2-bromo-5-thiocyanatobenzoate. InChIKey: KWNHXDQDGOIZDW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6BrNO2S
Molecular weight272.12 g/mol
IUPAC namemethyl 2-bromo-5-thiocyanatobenzoate
InChIKeyKWNHXDQDGOIZDW-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC(=C1)SC#N)Br

Computed by PubChem (NCBI)