CAS 933742-71-3 appears in our catalog under these names: (2-Bromo-benzothiazol-6-yl)-acetic acid, 95%, 2-(2-Bromobenzo(d)thiazol-6-yl)acetic acid, 97%, 2-(2-Bromo-1,3-benzothiazol-6-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
2-(2-bromo-1,3-benzothiazol-6-yl)acetic acid (CAS 933742-71-3) is a chemical compound with the molecular formula C9H6BrNO2S and a molecular weight of 272.12 g/mol. IUPAC name: 2-(2-bromo-1,3-benzothiazol-6-yl)acetic acid. InChIKey: KYIDMSYBOCCSSF-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2S |
|---|---|
| Molecular weight | 272.12 g/mol |
| IUPAC name | 2-(2-bromo-1,3-benzothiazol-6-yl)acetic acid |
| InChIKey | KYIDMSYBOCCSSF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CC(=O)O)SC(=N2)Br |
Computed by PubChem (NCBI)