CAS 2102409-58-3 appears in our catalog under these names: 4-Bromo-3-methylthieno[2,3-c]pyridine-2-carboxylic acid, 95%, 4-BROMO-3-METHYLTHIENO(2,3-C)PYRIDINE-2-CARBOXYLIC ACID, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 500mg, 1g.
4-bromo-3-methylthieno[2,3-c]pyridine-2-carboxylic acid (CAS 2102409-58-3) is a chemical compound with the molecular formula C9H6BrNO2S and a molecular weight of 272.12 g/mol. IUPAC name: 4-bromo-3-methylthieno[2,3-c]pyridine-2-carboxylic acid. InChIKey: HYQGKWAEBOOKFC-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2S |
|---|---|
| Molecular weight | 272.12 g/mol |
| IUPAC name | 4-bromo-3-methylthieno[2,3-c]pyridine-2-carboxylic acid |
| InChIKey | HYQGKWAEBOOKFC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=CN=CC(=C12)Br)C(=O)O |
Computed by PubChem (NCBI)