CAS 2578839-31-1 is the registry number for 5-Bromo-3-methylthieno[2,3-b]pyridine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-methylthieno[2,3-b]pyridine-2-carboxylic acid (CAS 2578839-31-1) is a chemical compound with the molecular formula C9H6BrNO2S and a molecular weight of 272.12 g/mol. IUPAC name: 5-bromo-3-methylthieno[2,3-b]pyridine-2-carboxylic acid. InChIKey: XQGVZOUABUVDJA-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2S |
|---|---|
| Molecular weight | 272.12 g/mol |
| IUPAC name | 5-bromo-3-methylthieno[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | XQGVZOUABUVDJA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=C(C=N2)Br)C(=O)O |
Computed by PubChem (NCBI)