CAS 904961-08-6 is the registry number for 3-(5-Bromothiazol-2-yloxy)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[(5-bromo-1,3-thiazol-2-yl)oxy]phenol (CAS 904961-08-6) is a chemical compound with the molecular formula C9H6BrNO2S and a molecular weight of 272.12 g/mol. IUPAC name: 3-[(5-bromo-1,3-thiazol-2-yl)oxy]phenol. InChIKey: HOOYSVYDGWBXRG-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2S |
|---|---|
| Molecular weight | 272.12 g/mol |
| IUPAC name | 3-[(5-bromo-1,3-thiazol-2-yl)oxy]phenol |
| InChIKey | HOOYSVYDGWBXRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=NC=C(S2)Br)O |
Computed by PubChem (NCBI)