CAS 1781975-10-7 is the registry number for 3-Bromo-5-hydroxy-4-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5-hydroxy-4-methylbenzoic acid (CAS 1781975-10-7) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 3-bromo-5-hydroxy-4-methylbenzoic acid. InChIKey: VPYSJQGETIIWSO-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 3-bromo-5-hydroxy-4-methylbenzoic acid |
| InChIKey | VPYSJQGETIIWSO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)C(=O)O)O |
Computed by PubChem (NCBI)