CAS 17825-58-0 appears in our catalog under these names: 2,3-Diphenylcycloprop-2-ene-1-carboxylic acid, 95%, 2,3-Diphenylcycloprop-2-enecarboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2,3-diphenylcycloprop-2-ene-1-carboxylic acid (CAS 17825-58-0) is a chemical compound with the molecular formula C16H12O2 and a molecular weight of 236.26 g/mol. IUPAC name: 2,3-diphenylcycloprop-2-ene-1-carboxylic acid. InChIKey: LRFRUFJNOGIAFA-UHFFFAOYSA-N.
| Molecular formula | C16H12O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 2,3-diphenylcycloprop-2-ene-1-carboxylic acid |
| InChIKey | LRFRUFJNOGIAFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C2C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)