CAS 84907-53-9 appears in our catalog under these names: 4,4'-(Ethene-1,2-diyl)dibenzaldehyde, 95%, (E)-4,4'-(Ethene-1,2-diyl)dibenzaldehyde, 95%, (E)–4,4'–(Ethene–1,2–diyl)dibenzaldehyde, (E)-4,4'-(Ethene-1,2-diyl)dibenzaldehyde, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4-[(E)-2-(4-formylphenyl)ethenyl]benzaldehyde (CAS 84907-53-9) is a chemical compound with the molecular formula C16H12O2 and a molecular weight of 236.26 g/mol. IUPAC name: 4-[(E)-2-(4-formylphenyl)ethenyl]benzaldehyde. InChIKey: NCAJMNHLAZAVRZ-OWOJBTEDSA-N.
| Molecular formula | C16H12O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 4-[(E)-2-(4-formylphenyl)ethenyl]benzaldehyde |
| InChIKey | NCAJMNHLAZAVRZ-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)C=O)C=O |
Computed by PubChem (NCBI)