Products 2279122-01-7

CAS 2279122-01-7 is the registry number for 4'-Ethynyl-biphenyl-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 3-(4-ethynylphenyl)benzoate (CAS 2279122-01-7) is a chemical compound with the molecular formula C16H12O2 and a molecular weight of 236.26 g/mol. IUPAC name: methyl 3-(4-ethynylphenyl)benzoate. InChIKey: RNIJJSOWEJYJAL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12O2
Molecular weight236.26 g/mol
IUPAC namemethyl 3-(4-ethynylphenyl)benzoate
InChIKeyRNIJJSOWEJYJAL-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC(=C1)C2=CC=C(C=C2)C#C

Computed by PubChem (NCBI)