Products 6531-35-7
CAS 6531-35-7 appears in our catalog under these names: 2,3-Dimethylanthraquinone, 95%, 2,3–Dimethyl–anthraquinone, 2,3-Dimethylanthraquinone, >95.0%(GC), 2,3-Dimethylanthraquinone 95%, 2,3-Dimethylanthracene-9,10-dione, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
2,3-dimethylanthracene-9,10-dione (CAS 6531-35-7) is a chemical compound with the molecular formula C16H12O2 and a molecular weight of 236.26 g/mol. IUPAC name: 2,3-dimethylanthracene-9,10-dione. InChIKey: KIJPZYXCIHZVGP-UHFFFAOYSA-N.
| Molecular formula | C16H12O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 2,3-dimethylanthracene-9,10-dione |
| InChIKey | KIJPZYXCIHZVGP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)
Synonyms:
2,3-Dimethylanthraquinone, 9,10-Anthracenedione, 2,3-dimethyl-, 2,3-dimethylanthracene-9,10-dione, 2,3-Dimethylanthra-9,10-quinone, 2,3-dimethyl-anthraquinone, 2,3-Dimethyl-9,10-anthracenedione, 9, 2,3-dimethyl-, orb1683819, 2,3-Dimethylanthraquinone, 98%, 2,3-dimethyl-anthracene-9,10-dione