Products 183589-09-5

CAS 183589-09-5 is the registry number for 2-(Phenylethynyl)phenyl acetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

[2-(2-phenylethynyl)phenyl] acetate (CAS 183589-09-5) is a chemical compound with the molecular formula C16H12O2 and a molecular weight of 236.26 g/mol. IUPAC name: [2-(2-phenylethynyl)phenyl] acetate. InChIKey: JUGJOYFNLDWBLU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12O2
Molecular weight236.26 g/mol
IUPAC name[2-(2-phenylethynyl)phenyl] acetate
InChIKeyJUGJOYFNLDWBLU-UHFFFAOYSA-N
SMILESCC(=O)OC1=CC=CC=C1C#CC2=CC=CC=C2

Computed by PubChem (NCBI)