Products 7561-48-0
CAS 7561-48-0 is the registry number for 2-(4-Methylphenyl)-1h-indene-1,3(2h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-methylphenyl)indene-1,3-dione (CAS 7561-48-0) is a chemical compound with the molecular formula C16H12O2 and a molecular weight of 236.26 g/mol. IUPAC name: 2-(4-methylphenyl)indene-1,3-dione. InChIKey: UZRVEOMTWFQDCD-UHFFFAOYSA-N.
| Molecular formula | C16H12O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 2-(4-methylphenyl)indene-1,3-dione |
| InChIKey | UZRVEOMTWFQDCD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)
Synonyms:
2-(p-Tolyl)-1H-indene-1,3(2H)-dione, 1,3-Indandione, 2-(4-methylphenyl)-, 2-(4-methylphenyl)indene-1,3-dione, 2-(4-methylphenyl)-2,3-dihydro-1H-indene-1,3-dione, 2-p-Tolyl-indan-1,3-dione, 2-(4-Methylphenyl)-1,3-indandione, 1H-Indene-1,3(2H)-dione, 2-(4-methylphenyl)-, Maybridge3_005874, Cambridge id 5103385, Oprea1_439782