Products 178270-52-5

CAS 178270-52-5 is the registry number for 2-{((4-Cyanophenyl)methyl)sulfanyl}acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-[(4-cyanophenyl)methylsulfanyl]acetic acid (CAS 178270-52-5) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 2-[(4-cyanophenyl)methylsulfanyl]acetic acid. InChIKey: YAPZRBCKDSHRQX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO2S
Molecular weight207.25 g/mol
IUPAC name2-[(4-cyanophenyl)methylsulfanyl]acetic acid
InChIKeyYAPZRBCKDSHRQX-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CSCC(=O)O)C#N

Computed by PubChem (NCBI)