Products 178306-49-5
CAS 178306-49-5 appears in our catalog under these names: Ambrisentan Impurity 2, 8-Hydroxy Efavirenz 8-O-Sulfate, (R)-2-Hydroxy-3-methoxy-3,3-diphenylpropanoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg.
(2R)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid (CAS 178306-49-5) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: (2R)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid. InChIKey: RQJWOLFMWKZKCJ-AWEZNQCLSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | (2R)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid |
| InChIKey | RQJWOLFMWKZKCJ-AWEZNQCLSA-N |
| SMILES | COC(C1=CC=CC=C1)(C2=CC=CC=C2)[C@H](C(=O)O)O |
Computed by PubChem (NCBI)