CAS 178306-52-0 appears in our catalog under these names: (S)-2-Hydroxy-3-methoxy-3,3-diphenylpropanoic acid, 97%, Ambrisentan Impurity 8, (S)-2-Hydroxy-3-methoxy-3,3-diphenylpropionic Acid, >95% (HPLC), (S)-2-Hydroxy-3-methoxy-3,3-diphenylpropionic Acid, (S)–2–Hydroxy–3–methoxy–3,3–diphenylpropionic Acid. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 1g, 10g, 5g, 250mg, on request, 100mg, 10mg, 4x25mg.
(2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid (CAS 178306-52-0) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid. InChIKey: RQJWOLFMWKZKCJ-CQSZACIVSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid |
| InChIKey | RQJWOLFMWKZKCJ-CQSZACIVSA-N |
| SMILES | COC(C1=CC=CC=C1)(C2=CC=CC=C2)[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)