CAS 178306-51-9 appears in our catalog under these names: Ambrisentan Impurity 9, 2-Hydroxy-3-methoxy-3,3-diphenylpropanoic Acid, >95% (HPLC), 2–Hydroxy–3–methoxy–3,3–diphenylpropanoic acid, 2-Hydroxy-3-methoxy-3,3-diphenylpropanoic acid 98%, 2-Hydroxy-3-methoxy-3,3-diphenylpropanoic acid, 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 250mg, 25g, 5g, 10g, 1g, 25MG, Get quote.
2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid (CAS 178306-51-9) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: 2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid. InChIKey: RQJWOLFMWKZKCJ-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid |
| InChIKey | RQJWOLFMWKZKCJ-UHFFFAOYSA-N |
| SMILES | COC(C1=CC=CC=C1)(C2=CC=CC=C2)C(C(=O)O)O |
Computed by PubChem (NCBI)