Products 1783401-99-9
CAS 1783401-99-9 is the registry number for 5-Methoxy-2-(1H-1,2,3-triazol-1-yl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-methoxy-2-(triazol-1-yl)benzoic acid (CAS 1783401-99-9) is a chemical compound with the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. IUPAC name: 5-methoxy-2-(triazol-1-yl)benzoic acid. InChIKey: XOOMZGZEYJZPFN-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 5-methoxy-2-(triazol-1-yl)benzoic acid |
| InChIKey | XOOMZGZEYJZPFN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N2C=CN=N2)C(=O)O |
Computed by PubChem (NCBI)