Products 1783643-89-9
CAS 1783643-89-9 is the registry number for 2-(2,2-Dimethyl-2,3-dihydro-1-benzofuran-7-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2,2-dimethyl-3H-1-benzofuran-7-yl)acetonitrile (CAS 1783643-89-9) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 2-(2,2-dimethyl-3H-1-benzofuran-7-yl)acetonitrile. InChIKey: VJCZMCILGJLFOL-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2-(2,2-dimethyl-3H-1-benzofuran-7-yl)acetonitrile |
| InChIKey | VJCZMCILGJLFOL-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)CC#N)C |
Computed by PubChem (NCBI)