Products 1783703-07-0
CAS 1783703-07-0 is the registry number for 7-Chloro-4-methoxy-1H-indazole-3-carboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg.
7-chloro-4-methoxy-2H-indazole-3-carboxylic acid (CAS 1783703-07-0) is a chemical compound with the molecular formula C9H7ClN2O3 and a molecular weight of 226.61 g/mol. IUPAC name: 7-chloro-4-methoxy-2H-indazole-3-carboxylic acid. InChIKey: SDEWNUPRTBLMDY-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O3 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | 7-chloro-4-methoxy-2H-indazole-3-carboxylic acid |
| InChIKey | SDEWNUPRTBLMDY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C2=NNC(=C12)C(=O)O)Cl |
Computed by PubChem (NCBI)