CAS 1783925-97-2 appears in our catalog under these names: 2-(Fluoromethyl)benzene-1-sulfonyl chloride, 2-(Fluoromethyl)benzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(fluoromethyl)benzenesulfonyl chloride (CAS 1783925-97-2) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 2-(fluoromethyl)benzenesulfonyl chloride. InChIKey: CVFPBQPRNOFIMX-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 2-(fluoromethyl)benzenesulfonyl chloride |
| InChIKey | CVFPBQPRNOFIMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CF)S(=O)(=O)Cl |
Computed by PubChem (NCBI)