Products 1784486-56-1
CAS 1784486-56-1 appears in our catalog under these names: 1-(2,2-Dimethylpropyl)-1H-pyrazole-5-carboxylic acid, 95%, 95%, 1-(2,2-Dimethylpropyl)-1H-pyrazole-5-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(2,2-dimethylpropyl)pyrazole-3-carboxylic acid (CAS 1784486-56-1) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 2-(2,2-dimethylpropyl)pyrazole-3-carboxylic acid. InChIKey: JGIZBJXJAAVIBA-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-(2,2-dimethylpropyl)pyrazole-3-carboxylic acid |
| InChIKey | JGIZBJXJAAVIBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CN1C(=CC=N1)C(=O)O |
Computed by PubChem (NCBI)