CAS 1784571-75-0 is the registry number for 5-(1H-1,2,3-Triazol-1-yl)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 2g, 1g.
5-(triazol-1-yl)pyridine-3-carboxylic acid (CAS 1784571-75-0) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 5-(triazol-1-yl)pyridine-3-carboxylic acid. InChIKey: TUPDNQMQMIOGHD-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 5-(triazol-1-yl)pyridine-3-carboxylic acid |
| InChIKey | TUPDNQMQMIOGHD-UHFFFAOYSA-N |
| SMILES | C1=CN(N=N1)C2=CN=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)