Products 1784857-27-7
CAS 1784857-27-7 appears in our catalog under these names: 2-(Isoxazolo[4,5-b]pyridin-3-yl)acetic acid, 95%, 95%, 2-(Isoxazolo[4,5-b]pyridin-3-yl)acetic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-([1,2]oxazolo[4,5-b]pyridin-3-yl)acetic acid (CAS 1784857-27-7) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-([1,2]oxazolo[4,5-b]pyridin-3-yl)acetic acid. InChIKey: LXUCEKSICMUWNW-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-([1,2]oxazolo[4,5-b]pyridin-3-yl)acetic acid |
| InChIKey | LXUCEKSICMUWNW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NO2)CC(=O)O)N=C1 |
Computed by PubChem (NCBI)