Products 1784872-30-5
CAS 1784872-30-5 is the registry number for Benzoic acid, 2-chloro-6-methoxy-4-(trifluoromethyl)-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-chloro-6-methoxy-4-(trifluoromethyl)benzoic acid (CAS 1784872-30-5) is a chemical compound with the molecular formula C9H6ClF3O3 and a molecular weight of 254.59 g/mol. IUPAC name: 2-chloro-6-methoxy-4-(trifluoromethyl)benzoic acid. InChIKey: SYAOZBOXQLEADK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O3 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | 2-chloro-6-methoxy-4-(trifluoromethyl)benzoic acid |
| InChIKey | SYAOZBOXQLEADK-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)