Products 1785-65-5
CAS 1785-65-5 is the registry number for 2-Acetoxy-1,4-naphthoquinone. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 500mg.
(1,4-dioxonaphthalen-2-yl) acetate (CAS 1785-65-5) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: (1,4-dioxonaphthalen-2-yl) acetate. InChIKey: QHISPATYFAPAKC-UHFFFAOYSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | (1,4-dioxonaphthalen-2-yl) acetate |
| InChIKey | QHISPATYFAPAKC-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)
Synonyms:
2-Acetoxy-1,4-naphthoquinone, 2-(Acetyloxy)-1,4-naphthalenedione, 2-Hydroxy-1,4-naphthoquinone acetate, 1,4-Naphthoquinone, 2-hydroxy-, acetate, QHISPATYFAPAKC-UHFFFAOYSA-N, 1,4-dioxo-1,4-dihydronaphthalen-2-yl acetate, (1,4-dioxonaphthalen-2-yl) acetate, 1, 2-(acetyloxy)-, 1, 2-hydroxy-, acetate, NCIOpen2_006803