Products 1785552-75-1

CAS 1785552-75-1 is the registry number for 6-Chloroimidazo[1,2-a]pyrazine-3-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-chloroimidazo[1,2-a]pyrazine-3-carboxylic acid (CAS 1785552-75-1) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 6-chloroimidazo[1,2-a]pyrazine-3-carboxylic acid. InChIKey: VKRLSRHCERQYCH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClN3O2
Molecular weight197.58 g/mol
IUPAC name6-chloroimidazo[1,2-a]pyrazine-3-carboxylic acid
InChIKeyVKRLSRHCERQYCH-UHFFFAOYSA-N
SMILESC1=C(N2C=C(N=CC2=N1)Cl)C(=O)O

Computed by PubChem (NCBI)