CAS 1785552-75-1 is the registry number for 6-Chloroimidazo[1,2-a]pyrazine-3-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloroimidazo[1,2-a]pyrazine-3-carboxylic acid (CAS 1785552-75-1) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 6-chloroimidazo[1,2-a]pyrazine-3-carboxylic acid. InChIKey: VKRLSRHCERQYCH-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 6-chloroimidazo[1,2-a]pyrazine-3-carboxylic acid |
| InChIKey | VKRLSRHCERQYCH-UHFFFAOYSA-N |
| SMILES | C1=C(N2C=C(N=CC2=N1)Cl)C(=O)O |
Computed by PubChem (NCBI)