Products 1785562-84-6

CAS 1785562-84-6 is the registry number for 3-Methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid (CAS 1785562-84-6) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 3-methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid. InChIKey: AQKJNETYOBRNQL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO3
Molecular weight193.20 g/mol
IUPAC name3-methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid
InChIKeyAQKJNETYOBRNQL-UHFFFAOYSA-N
SMILESCC1C(OC2=CC=CC=C2N1)C(=O)O

Computed by PubChem (NCBI)