CAS 1787868-17-0 appears in our catalog under these names: 1-{4,5-dimethyl-4H,7H-(1,2,4)triazolo(1,5-a)pyrimidin-6-yl}ethan-1-one, 95%, 1-{4,5-Dimethyl-4H,7H-(1,2,4)triazolo(1,5-a)pyrimidin-6-yl}ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(4,5-dimethyl-7H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone (CAS 1787868-17-0) is a chemical compound with the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. IUPAC name: 1-(4,5-dimethyl-7H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone. InChIKey: GWRLKZKVDPPRMA-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O |
|---|---|
| Molecular weight | 192.22 g/mol |
| IUPAC name | 1-(4,5-dimethyl-7H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone |
| InChIKey | GWRLKZKVDPPRMA-UHFFFAOYSA-N |
| SMILES | CC1=C(CN2C(=NC=N2)N1C)C(=O)C |
Computed by PubChem (NCBI)