Products 17900-95-7
CAS 17900-95-7 appears in our catalog under these names: 5,6-Dibromo-1H-indole-3-carbaldehyde, 95%, 5，6–Dibromo–1H–indole–3–carbaldehyde, 5,6-dibromo-1H-indole-3-carbaldehyde/ 98.67% (existing batch purity), 5,6-Dibromo-1H-indole-3-carbaldehyde, 5,6-dibromo-1H-indole-3-carbaldehyde 97%. Offered by: Fluorochem, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5mg, 10mg, 25mg, 50mg, 200mg.
5,6-dibromo-1H-indole-3-carbaldehyde (CAS 17900-95-7) is a chemical compound with the molecular formula C9H5Br2NO and a molecular weight of 302.95 g/mol. IUPAC name: 5,6-dibromo-1H-indole-3-carbaldehyde. InChIKey: YQUFUBJNKCIXAA-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO |
|---|---|
| Molecular weight | 302.95 g/mol |
| IUPAC name | 5,6-dibromo-1H-indole-3-carbaldehyde |
| InChIKey | YQUFUBJNKCIXAA-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)Br)NC=C2C=O |
Computed by PubChem (NCBI)