CAS 179110-08-8 is the registry number for (7-Chloro-1,3-benzodioxol-5-yl)methanol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
(7-chloro-1,3-benzodioxol-5-yl)methanol (CAS 179110-08-8) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: (7-chloro-1,3-benzodioxol-5-yl)methanol. InChIKey: FSWCGDRZCGPHEH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | (7-chloro-1,3-benzodioxol-5-yl)methanol |
| InChIKey | FSWCGDRZCGPHEH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)CO)Cl |
Computed by PubChem (NCBI)