Products 17920-86-4
CAS 17920-86-4 appears in our catalog under these names: Bis(furan-2-yl) Methanone, bis(furan-2-yl)methanone, Di(furan-2-yl)methanone 97%, Di(furan-2-yl)methanone, 97%, 97%, Di-furan-2-yl-methanone, 97%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 5g, 250mg.
Bis(furan-2-yl)methanone (CAS 17920-86-4) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: bis(furan-2-yl)methanone. InChIKey: HMKCSFHWMJHMTG-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | bis(furan-2-yl)methanone |
| InChIKey | HMKCSFHWMJHMTG-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)