CAS 179232-29-2 appears in our catalog under these names: Methyl 4–bromo–2–fluorobenzoate, Methyl 4-bromo-2-fluorobenzoate 98%, Methyl 4-bromo-2-fluorobenzoate, 97%, 4-Bromo-2-fluorobenzoic Acid Methyl Ester, Methyl 4-Bromo-2-fluorobenzoate, >98.0%(GC). Offered by: GLPBio, Ambeed, Fluorochem, TRC, TCI. Available pack sizes: 100g, 25g, 500g, 5g, 10g, 1000g, 1g, 1kg.
Methyl 4-bromo-2-fluorobenzoate (CAS 179232-29-2) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: methyl 4-bromo-2-fluorobenzoate. InChIKey: DLILIUSWDLJMCE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | methyl 4-bromo-2-fluorobenzoate |
| InChIKey | DLILIUSWDLJMCE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)