CAS 179408-53-8 is the registry number for Methyl 6-thien-2-ylnicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 6-thiophen-2-ylpyridine-3-carboxylate (CAS 179408-53-8) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: methyl 6-thiophen-2-ylpyridine-3-carboxylate. InChIKey: SXGLIAOLXVLUCM-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | methyl 6-thiophen-2-ylpyridine-3-carboxylate |
| InChIKey | SXGLIAOLXVLUCM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1)C2=CC=CS2 |
Computed by PubChem (NCBI)