CAS 179412-79-4 appears in our catalog under these names: (S)–3–((tert–Butoxycarbonyl)amino)–4–methylpentanoic acid, Boc-d-beta-homovaline, 98%, (3S)-3-{((tert-butoxy)carbonyl)amino}-4-methylpentanoic acid, Boc-D-β-HoVal-OH 97%, (S)-3-((tert-Butoxycarbonyl)amino)-4-methylpentanoic acid, 97%, 97%. Offered by: GLPBio, Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
(3S)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 179412-79-4) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (3S)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: LUXMZCJCTUATDM-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (3S)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | LUXMZCJCTUATDM-QMMMGPOBSA-N |
| SMILES | CC(C)[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)