CAS 183990-64-9 appears in our catalog under these names: Boc–β–HoVal–OH, Boc-L-beta-HVal-OH, N-Boc-L-beta-leucine, 95% , (R)-3-((tert-Butoxycarbonyl)amino)-4-methylpentanoic acid, 97%, 97%, (R)-3-((tert-Butoxycarbonyl)amino)-4-methylpentanoic acid, 97%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 100mg, 250mg.
(3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 183990-64-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: LUXMZCJCTUATDM-MRVPVSSYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | LUXMZCJCTUATDM-MRVPVSSYSA-N |
| SMILES | CC(C)[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)