Products 1794766-80-5
CAS 1794766-80-5 is the registry number for p-Nitrophenyl Acetate-13C,d3, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
(4-nitrophenyl) 2,2,2-trideuterioacetate (CAS 1794766-80-5) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 185.16 g/mol. IUPAC name: (4-nitrophenyl) 2,2,2-trideuterioacetate. InChIKey: QAUUDNIGJSLPSX-HMHIGVJUSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 185.16 g/mol |
| IUPAC name | (4-nitrophenyl) 2,2,2-trideuterioacetate |
| InChIKey | QAUUDNIGJSLPSX-HMHIGVJUSA-N |
| SMILES | [2H]C([2H])([2H])[13C](=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)