Products 1795135-93-1
CAS 1795135-93-1 is the registry number for (Z)–3–(4–Amino–3，5–dimethylphenyl)acrylonitrile–d6. Offered by: GLPBio. Available pack sizes: 5mg.
(Z)-3-[4-amino-3,5-bis(trideuteriomethyl)phenyl]prop-2-enenitrile (CAS 1795135-93-1) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 178.26 g/mol. IUPAC name: (Z)-3-[4-amino-3,5-bis(trideuteriomethyl)phenyl]prop-2-enenitrile. InChIKey: JNRBSZUSHVFWIK-WUVOMKSVSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 178.26 g/mol |
| IUPAC name | (Z)-3-[4-amino-3,5-bis(trideuteriomethyl)phenyl]prop-2-enenitrile |
| InChIKey | JNRBSZUSHVFWIK-WUVOMKSVSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC(=C1N)C([2H])([2H])[2H])/C=C\C#N |
Computed by PubChem (NCBI)