CAS 661489-22-1 is the registry number for Rilpivirine Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-3-(4-amino-3,5-dimethylphenyl)prop-2-enenitrile (CAS 661489-22-1) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: (Z)-3-(4-amino-3,5-dimethylphenyl)prop-2-enenitrile. InChIKey: JNRBSZUSHVFWIK-ARJAWSKDSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | (Z)-3-(4-amino-3,5-dimethylphenyl)prop-2-enenitrile |
| InChIKey | JNRBSZUSHVFWIK-ARJAWSKDSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)/C=C\C#N |
Computed by PubChem (NCBI)