Products 1795142-65-2
CAS 1795142-65-2 is the registry number for 3-Butylidene Phthalide-d8. Offered by: TRC. Available pack sizes: 25mg.
(3Z)-3-(1,2,2,3,3,4,4,4-octadeuteriobutylidene)-2-benzofuran-1-one (CAS 1795142-65-2) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 196.27 g/mol. IUPAC name: (3Z)-3-(1,2,2,3,3,4,4,4-octadeuteriobutylidene)-2-benzofuran-1-one. InChIKey: WMBOCUXXNSOQHM-IKGHHJFWSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 196.27 g/mol |
| IUPAC name | (3Z)-3-(1,2,2,3,3,4,4,4-octadeuteriobutylidene)-2-benzofuran-1-one |
| InChIKey | WMBOCUXXNSOQHM-IKGHHJFWSA-N |
| SMILES | [2H]/C(=C/1\C2=CC=CC=C2C(=O)O1)/C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)