CAS 1795276-46-8 appears in our catalog under these names: 5-Bromo-1-(2-oxopropyl)-1,2-dihydropyridin-2-one hydrochloride, 95%, 5-Bromo-1-(2-oxopropyl)-1,2-dihydropyridin-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-bromo-1-(2-oxopropyl)pyridin-2-one;hydrochloride (CAS 1795276-46-8) is a chemical compound with the molecular formula C8H9BrClNO2 and a molecular weight of 266.52 g/mol. IUPAC name: 5-bromo-1-(2-oxopropyl)pyridin-2-one;hydrochloride. InChIKey: OOGVCWWLLIUDBT-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO2 |
|---|---|
| Molecular weight | 266.52 g/mol |
| IUPAC name | 5-bromo-1-(2-oxopropyl)pyridin-2-one;hydrochloride |
| InChIKey | OOGVCWWLLIUDBT-UHFFFAOYSA-N |
| SMILES | CC(=O)CN1C=C(C=CC1=O)Br.Cl |
Computed by PubChem (NCBI)