CAS 1795662-62-2 appears in our catalog under these names: 5-Bromobenzo[d][1,3]dioxole-4-carbonitrile, 98%, 98%, 5-Bromobenzo[d][1,3]dioxole-4-carbonitrile, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1,3-benzodioxole-4-carbonitrile (CAS 1795662-62-2) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 5-bromo-1,3-benzodioxole-4-carbonitrile. InChIKey: RTMNHQOZDWSUOI-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 5-bromo-1,3-benzodioxole-4-carbonitrile |
| InChIKey | RTMNHQOZDWSUOI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Br)C#N |
Computed by PubChem (NCBI)