CAS 17969-25-4 appears in our catalog under these names: [2-(2-Chlorophenyl)-1,3-thiazol-4-yl]acetic acid, 95%, 2-(2-(2-Chlorophenyl)thiazol-4-yl)acetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.
2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid (CAS 17969-25-4) is a chemical compound with the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. IUPAC name: 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid. InChIKey: YHTKTBSWVKJNQG-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2S |
|---|---|
| Molecular weight | 253.71 g/mol |
| IUPAC name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | YHTKTBSWVKJNQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=CS2)CC(=O)O)Cl |
Computed by PubChem (NCBI)