Products 905808-17-5

CAS 905808-17-5 is the registry number for 2-Methyl-4-(3-chloro)phenyl thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(3-chlorophenyl)-2-methyl-1,3-thiazole-5-carboxylic acid (CAS 905808-17-5) is a chemical compound with the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. IUPAC name: 4-(3-chlorophenyl)-2-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: QUEKDZOAFACIFE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClNO2S
Molecular weight253.71 g/mol
IUPAC name4-(3-chlorophenyl)-2-methyl-1,3-thiazole-5-carboxylic acid
InChIKeyQUEKDZOAFACIFE-UHFFFAOYSA-N
SMILESCC1=NC(=C(S1)C(=O)O)C2=CC(=CC=C2)Cl

Computed by PubChem (NCBI)