Products 55315-33-8
CAS 55315-33-8 appears in our catalog under these names: 2-(1,3-Benzodioxol-5-yl)-4-(chloromethyl)-1,3-thiazole, 95%, 2-(1,3-Benzodioxol-5-yl)-4-(chloromethyl)-1,3-thiazole, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-(1,3-benzodioxol-5-yl)-4-(chloromethyl)-1,3-thiazole (CAS 55315-33-8) is a chemical compound with the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-4-(chloromethyl)-1,3-thiazole. InChIKey: DXTWZFZBGJRQHR-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2S |
|---|---|
| Molecular weight | 253.71 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-4-(chloromethyl)-1,3-thiazole |
| InChIKey | DXTWZFZBGJRQHR-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NC(=CS3)CCl |
Computed by PubChem (NCBI)