Products 17969-26-5

CAS 17969-26-5 is the registry number for [2-(3-Chlorophenyl)-1,3-thiazol-4-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]acetic acid (CAS 17969-26-5) is a chemical compound with the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. IUPAC name: 2-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]acetic acid. InChIKey: CCUFHQQWZTVOCR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClNO2S
Molecular weight253.71 g/mol
IUPAC name2-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]acetic acid
InChIKeyCCUFHQQWZTVOCR-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)C2=NC(=CS2)CC(=O)O

Computed by PubChem (NCBI)