CAS 477872-93-8 appears in our catalog under these names: 2-(4-Chlorobenzyl)thiazole-4-carboxylic acid, 97%, 2-(4-Chlorobenzyl)thiazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 25g, 5g, 1g, 2,5g.
2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid (CAS 477872-93-8) is a chemical compound with the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. IUPAC name: 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid. InChIKey: OSEQLEYPYMSQBU-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2S |
|---|---|
| Molecular weight | 253.71 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | OSEQLEYPYMSQBU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NC(=CS2)C(=O)O)Cl |
Computed by PubChem (NCBI)