CAS 253315-24-1 is the registry number for 2-(2-Chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.
2-(2-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 253315-24-1) is a chemical compound with the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. IUPAC name: 2-(2-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: XLBHXZVHSAASRX-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2S |
|---|---|
| Molecular weight | 253.71 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | XLBHXZVHSAASRX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)