CAS 1796948-30-5 is the registry number for (2,5-Dimethylphenyl)(phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(2,5-dimethylphenyl)-phenylmethanamine;hydrochloride (CAS 1796948-30-5) is a chemical compound with the molecular formula C15H18ClN and a molecular weight of 247.76 g/mol. IUPAC name: (2,5-dimethylphenyl)-phenylmethanamine;hydrochloride. InChIKey: YJAKXFLZOZLRGP-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN |
|---|---|
| Molecular weight | 247.76 g/mol |
| IUPAC name | (2,5-dimethylphenyl)-phenylmethanamine;hydrochloride |
| InChIKey | YJAKXFLZOZLRGP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)