CAS 1798-99-8 appears in our catalog under these names: 3-Bromophenoxyacetic acid, 98%, 2-(3-Bromophenoxy)acetic acid 98%, 2-(3-Bromophenoxy)acetic acid, 98%, 98%, (3-bromophenoxy)acetic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 100g, 100mg, 250mg.
2-(3-bromophenoxy)acetic acid (CAS 1798-99-8) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(3-bromophenoxy)acetic acid. InChIKey: CRKQPDCSWOJBJY-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(3-bromophenoxy)acetic acid |
| InChIKey | CRKQPDCSWOJBJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)OCC(=O)O |
Computed by PubChem (NCBI)