CAS 179942-58-6 is the registry number for 2-(3-Bromo-4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane. Offered by: TRC. Available pack sizes: 250mg.
2-(3-bromo-4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane (CAS 179942-58-6) is a chemical compound with the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. IUPAC name: 2-(3-bromo-4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane. InChIKey: FTYNTOQCCHAXGR-UHFFFAOYSA-N.
| Molecular formula | C13H17BrO3 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | 2-(3-bromo-4-methoxyphenyl)-5,5-dimethyl-1,3-dioxane |
| InChIKey | FTYNTOQCCHAXGR-UHFFFAOYSA-N |
| SMILES | CC1(COC(OC1)C2=CC(=C(C=C2)OC)Br)C |
Computed by PubChem (NCBI)